ChemNet > CAS > 301334-92-9 4-[4-(2-methoxyphenyl)piperidino]-3-nitrobenzaldehyd
301334-92-9 4-[4-(2-methoxyphenyl)piperidino]-3-nitrobenzaldehyd
| Produkt-Name |
4-[4-(2-methoxyphenyl)piperidino]-3-nitrobenzaldehyd |
| Synonyme |
4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrobenzaldehyd |
| Englischer Name |
4-[4-(2-methoxyphenyl)piperidino]-3-nitrobenzaldehyde;4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrobenzaldehyde |
| Molekulare Formel |
C19H20N2O4 |
| Molecular Weight |
340.3731 |
| InChI |
InChI=1/C19H20N2O4/c1-25-19-5-3-2-4-16(19)15-8-10-20(11-9-15)17-7-6-14(13-22)12-18(17)21(23)24/h2-7,12-13,15H,8-11H2,1H3 |
| CAS Registry Number |
301334-92-9 |
| Molecular Structure |
|
| Dichte |
1.244g/cm3 |
| Schmelzpunkt |
116℃ |
| Siedepunkt |
521°C at 760 mmHg |
| Brechungsindex |
1.615 |
| Flammpunkt |
268.9°C |
| Dampfdruck |
5.93E-11mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|